C22H30ClF2N3O4 — CID 69075403
5-fluoro-2-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride (PubChem CID 69075403) has the molecular formula C22H30ClF2N3O4 and a molecular weight of 473.95 g/mol. Its IUPAC name is 5-fluoro-2-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride.
| Compound Name | 5-fluoro-2-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 69075403 |
| Molecular Formula | C22H30ClF2N3O4 |
| Molecular Weight | 473.95 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 5-fluoro-2-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-6-hydroxy-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione;hydrochloride |
| SMILES | COc1ccc(F)cc1N1CCN(CCCN2C(=O)C3CC(O)C(F)CC3C2=O)CC1.Cl |
| InChI | InChI=1S/C22H29F2N3O4.ClH/c1-31-20-4-3-14(23)11-18(20)26-9-7-25(8-10-26)5-2-6-27-21(29)15-12-17(24)19(28)13-16(15)22(27)30;/h3-4,11,15-17,19,28H,2,5-10,12-13H2,1H3;1H |
| InChIKey | HAYKKIBRMVGYRP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.95 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|