C21H30FN3O3 — CID 11502029
1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,3,4-trimethylpyrrolidine-2,5-dione (PubChem CID 11502029) has the molecular formula C21H30FN3O3 and a molecular weight of 391.49 g/mol. Its IUPAC name is 1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,3,4-trimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,3,4-trimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11502029 |
| Molecular Formula | C21H30FN3O3 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-[3-[4-(5-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-3,3,4-trimethylpyrrolidine-2,5-dione |
| SMILES | COc1ccc(F)cc1N1CCN(CCCN2C(=O)C(C)C(C)(C)C2=O)CC1 |
| InChI | InChI=1S/C21H30FN3O3/c1-15-19(26)25(20(27)21(15,2)3)9-5-8-23-10-12-24(13-11-23)17-14-16(22)6-7-18(17)28-4/h6-7,14-15H,5,8-13H2,1-4H3 |
| InChIKey | LIEDKMXZOMVBSE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|