C20H27FN4O4 — CID 70207167
1-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 70207167) has the molecular formula C20H27FN4O4 and a molecular weight of 406.46 g/mol. Its IUPAC name is 1-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70207167 |
| Molecular Formula | C20H27FN4O4 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-[3-[4-(4-fluoro-2-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(F)ccc1N1CCN(CCCN2C(=O)NC(=O)C(C)(C)C2=O)CC1 |
| InChI | InChI=1S/C20H27FN4O4/c1-20(2)17(26)22-19(28)25(18(20)27)8-4-7-23-9-11-24(12-10-23)15-6-5-14(21)13-16(15)29-3/h5-6,13H,4,7-12H2,1-3H3,(H,22,26,28) |
| InChIKey | BTVOSKCNOBVGLP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|