C21H26F4N4O4 — CID 70202309
1-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 70202309) has the molecular formula C21H26F4N4O4 and a molecular weight of 474.46 g/mol. Its IUPAC name is 1-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70202309 |
| Molecular Formula | C21H26F4N4O4 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-5,5-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)C(=O)NC(=O)N(CCCN2CCN(c3ccc(F)cc3OCC(F)(F)F)CC2)C1=O |
| InChI | InChI=1S/C21H26F4N4O4/c1-20(2)17(30)26-19(32)29(18(20)31)7-3-6-27-8-10-28(11-9-27)15-5-4-14(22)12-16(15)33-13-21(23,24)25/h4-5,12H,3,6-11,13H2,1-2H3,(H,26,30,32) |
| InChIKey | XPTSJALWOMJECN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|