C20H25F4N3O3 — CID 11683423
1-[3-[4-[5-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]piperidine-2,6-dione (PubChem CID 11683423) has the molecular formula C20H25F4N3O3 and a molecular weight of 431.43 g/mol. Its IUPAC name is 1-[3-[4-[5-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]piperidine-2,6-dione.
| Compound Name | 1-[3-[4-[5-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 11683423 |
| Molecular Formula | C20H25F4N3O3 |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-[3-[4-[5-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1CCCN1CCN(c2cc(F)ccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C20H25F4N3O3/c21-15-5-6-17(30-14-20(22,23)24)16(13-15)26-11-9-25(10-12-26)7-2-8-27-18(28)3-1-4-19(27)29/h5-6,13H,1-4,7-12,14H2 |
| InChIKey | RCKAJBBKVKPHEZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|