C15H20BrF3N2O — CID 70202671
1-(3-bromopropyl)-4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazine (PubChem CID 70202671) has the molecular formula C15H20BrF3N2O and a molecular weight of 381.24 g/mol. Its IUPAC name is 1-(3-bromopropyl)-4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazine.
| Compound Name | 1-(3-bromopropyl)-4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 70202671 |
| Molecular Formula | C15H20BrF3N2O |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-(3-bromopropyl)-4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazine |
| SMILES | FC(F)(F)COc1ccccc1N1CCN(CCCBr)CC1 |
| InChI | InChI=1S/C15H20BrF3N2O/c16-6-3-7-20-8-10-21(11-9-20)13-4-1-2-5-14(13)22-12-15(17,18)19/h1-2,4-5H,3,6-12H2 |
| InChIKey | FPGCIEJQYIPOEI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|