C18H22F3N3O3S — CID 11554265
3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione (PubChem CID 11554265) has the molecular formula C18H22F3N3O3S and a molecular weight of 417.45 g/mol. Its IUPAC name is 3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 11554265 |
| Molecular Formula | C18H22F3N3O3S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-[3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1CCCN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H22F3N3O3S/c19-18(20,21)13-27-15-5-2-1-4-14(15)23-10-8-22(9-11-23)6-3-7-24-16(25)12-28-17(24)26/h1-2,4-5H,3,6-13H2 |
| InChIKey | WMAWOVHKXZYVAB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|