C23H27F4N3O3 — CID 11190585
2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 11190585) has the molecular formula C23H27F4N3O3 and a molecular weight of 469.48 g/mol. Its IUPAC name is 2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11190585 |
| Molecular Formula | C23H27F4N3O3 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 2-[3-[4-[4-fluoro-2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1CCCN1CCN(c2ccc(F)cc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C23H27F4N3O3/c24-16-6-7-19(20(14-16)33-15-23(25,26)27)29-12-10-28(11-13-29)8-3-9-30-21(31)17-4-1-2-5-18(17)22(30)32/h1-2,6-7,14,17-18H,3-5,8-13,15H2 |
| InChIKey | FFZZHHNCBLDGPL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|