C23H28F3N3O4 — CID 11511074
2-[(2S)-2-hydroxy-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 11511074) has the molecular formula C23H28F3N3O4 and a molecular weight of 467.49 g/mol. Its IUPAC name is 2-[(2S)-2-hydroxy-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-hydroxy-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11511074 |
| Molecular Formula | C23H28F3N3O4 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-[(2S)-2-hydroxy-3-[4-[2-(2,2,2-trifluoroethoxy)phenyl]piperazin-1-yl]propyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1C[C@@H](O)CN1CCN(c2ccccc2OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C23H28F3N3O4/c24-23(25,26)15-33-20-8-4-3-7-19(20)28-11-9-27(10-12-28)13-16(30)14-29-21(31)17-5-1-2-6-18(17)22(29)32/h1-4,7-8,16-18,30H,5-6,9-15H2/t16-,17?,18?/m0/s1 |
| InChIKey | LRZXDVZRPHPZRQ-AOCRQIFASA-N |
| XLogP | 2.06 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|