C17H18FNO4 — CID 124742317
(3aR,7aR)-2-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 124742317) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is (3aR,7aR)-2-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124742317 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (3aR,7aR)-2-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1C[C@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO4/c18-11-5-7-13(8-6-11)23-10-12(20)9-19-16(21)14-3-1-2-4-15(14)17(19)22/h1-2,5-8,12,14-15,20H,3-4,9-10H2/t12-,14+,15+/m0/s1 |
| InChIKey | XTSDJKNDLBTWDL-NWANDNLSSA-N |
| XLogP | 1.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|