C18H23FN2O4 — CID 31576115
3-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 31576115) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 31576115 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[(2S)-3-(4-fluorophenoxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(C[C@H](O)COc2ccc(F)cc2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C18H23FN2O4/c1-20-17(24)21(16(23)18(20)9-3-2-4-10-18)11-14(22)12-25-15-7-5-13(19)6-8-15/h5-8,14,22H,2-4,9-12H2,1H3/t14-/m0/s1 |
| InChIKey | QQZGJNYHIZRFMB-AWEZNQCLSA-N |
| XLogP | 2.16 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|