C19H24N2O6 — CID 52502610
3-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 52502610) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is 3-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 52502610 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 3-[(2S)-3-(1,3-benzodioxol-5-yloxy)-2-hydroxypropyl]-1-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(C[C@H](O)COc2ccc3c(c2)OCO3)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C19H24N2O6/c1-20-18(24)21(17(23)19(20)7-3-2-4-8-19)10-13(22)11-25-14-5-6-15-16(9-14)27-12-26-15/h5-6,9,13,22H,2-4,7-8,10-12H2,1H3/t13-/m0/s1 |
| InChIKey | DUTSPPQAGIFGIP-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|