C16H18FNO4S — CID 94799111
(5R)-2-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 94799111) has the molecular formula C16H18FNO4S and a molecular weight of 339.39 g/mol. Its IUPAC name is (5R)-2-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | (5R)-2-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 94799111 |
| Molecular Formula | C16H18FNO4S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (5R)-2-[(2R)-3-(4-fluorophenoxy)-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1C[C@@]2(CCSC2)C(=O)N1C[C@@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FNO4S/c17-11-1-3-13(4-2-11)22-9-12(19)8-18-14(20)7-16(15(18)21)5-6-23-10-16/h1-4,12,19H,5-10H2/t12-,16-/m1/s1 |
| InChIKey | LGVQEIANXDGBIA-MLGOLLRUSA-N |
| XLogP | 1.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|