C16H17N3O4S — CID 31574507
4-[(2R)-3-[(5R)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]-2-hydroxypropoxy]benzonitrile (PubChem CID 31574507) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 4-[(2R)-3-[(5R)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[(2R)-3-[(5R)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 31574507 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-[(2R)-3-[(5R)-2,4-dioxo-7-thia-1,3-diazaspiro[4.4]nonan-3-yl]-2-hydroxypropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OC[C@H](O)CN2C(=O)N[C@]3(CCSC3)C2=O)cc1 |
| InChI | InChI=1S/C16H17N3O4S/c17-7-11-1-3-13(4-2-11)23-9-12(20)8-19-14(21)16(18-15(19)22)5-6-24-10-16/h1-4,12,20H,5-6,8-10H2,(H,18,22)/t12-,16+/m1/s1 |
| InChIKey | UJHAQCAICPQWFR-WBMJQRKESA-N |
| XLogP | 0.73 |
| TPSA | 102.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|