C17H20ClNO4S — CID 95345247
(5S)-2-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 95345247) has the molecular formula C17H20ClNO4S and a molecular weight of 369.87 g/mol. Its IUPAC name is (5S)-2-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | (5S)-2-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 95345247 |
| Molecular Formula | C17H20ClNO4S |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | (5S)-2-[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-7-thia-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1C[C@]2(CCSC2)C(=O)N1C[C@@H](O)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClNO4S/c18-13-3-1-12(2-4-13)9-23-10-14(20)8-19-15(21)7-17(16(19)22)5-6-24-11-17/h1-4,14,20H,5-11H2/t14-,17+/m1/s1 |
| InChIKey | WSKBQDGUMLNPCF-PBHICJAKSA-N |
| XLogP | 2.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|