C19H24ClNO4 — CID 26009717
2-[(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione (PubChem CID 26009717) has the molecular formula C19H24ClNO4 and a molecular weight of 365.86 g/mol. Its IUPAC name is 2-[(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione.
| Compound Name | 2-[(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione |
|---|---|
| PubChem CID | 26009717 |
| Molecular Formula | C19H24ClNO4 |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[(2R)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-2-azaspiro[4.5]decane-1,3-dione |
| SMILES | O=C1CC2(CCCCC2)C(=O)N1C[C@@H](O)COCc1ccccc1Cl |
| InChI | InChI=1S/C19H24ClNO4/c20-16-7-3-2-6-14(16)12-25-13-15(22)11-21-17(23)10-19(18(21)24)8-4-1-5-9-19/h2-3,6-7,15,22H,1,4-5,8-13H2/t15-/m1/s1 |
| InChIKey | QYPHRUCQRSRZTI-OAHLLOKOSA-N |
| XLogP | 2.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|