C18H25ClN2O4 — CID 39972628
(5S)-5-butyl-3-[(2S)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 39972628) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is (5S)-5-butyl-3-[(2S)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-butyl-3-[(2S)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 39972628 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (5S)-5-butyl-3-[(2S)-3-[(2-chlorophenyl)methoxy]-2-hydroxypropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCC[C@]1(C)NC(=O)N(C[C@H](O)COCc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C18H25ClN2O4/c1-3-4-9-18(2)16(23)21(17(24)20-18)10-14(22)12-25-11-13-7-5-6-8-15(13)19/h5-8,14,22H,3-4,9-12H2,1-2H3,(H,20,24)/t14-,18-/m0/s1 |
| InChIKey | CKDTWQYEHHWVHT-KSSFIOAISA-N |
| XLogP | 2.72 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|