C19H28N2O4 — CID 18275453
5-hexyl-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione (PubChem CID 18275453) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 5-hexyl-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-hexyl-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18275453 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 5-hexyl-3-(2-hydroxy-3-phenoxypropyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCCCC1(C)NC(=O)N(CC(O)COc2ccccc2)C1=O |
| InChI | InChI=1S/C19H28N2O4/c1-3-4-5-9-12-19(2)17(23)21(18(24)20-19)13-15(22)14-25-16-10-7-6-8-11-16/h6-8,10-11,15,22H,3-5,9,12-14H2,1-2H3,(H,20,24) |
| InChIKey | DTJDWAOBEKUTGE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|