C19H35N3O3 — CID 47556194
5-hexyl-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 47556194) has the molecular formula C19H35N3O3 and a molecular weight of 353.51 g/mol. Its IUPAC name is 5-hexyl-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-hexyl-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47556194 |
| Molecular Formula | C19H35N3O3 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 5-hexyl-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCCCCC1(C)NC(=O)N(CC(O)CN2CCC(C)CC2)C1=O |
| InChI | InChI=1S/C19H35N3O3/c1-4-5-6-7-10-19(3)17(24)22(18(25)20-19)14-16(23)13-21-11-8-15(2)9-12-21/h15-16,23H,4-14H2,1-3H3,(H,20,25) |
| InChIKey | INOBFBWOIAFLGV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|