C17H25N3O4 — CID 47556335
5-(furan-2-yl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 47556335) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(furan-2-yl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47556335 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 5-(furan-2-yl)-3-[2-hydroxy-3-(4-methylpiperidin-1-yl)propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1CCN(CC(O)CN2C(=O)NC(C)(c3ccco3)C2=O)CC1 |
| InChI | InChI=1S/C17H25N3O4/c1-12-5-7-19(8-6-12)10-13(21)11-20-15(22)17(2,18-16(20)23)14-4-3-9-24-14/h3-4,9,12-13,21H,5-8,10-11H2,1-2H3,(H,18,23) |
| InChIKey | CRYUGOGHSIUFBO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|