C16H22N2O4 — CID 111476351
5-(furan-2-yl)-3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 111476351) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 5-(furan-2-yl)-3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(furan-2-yl)-3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 111476351 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 5-(furan-2-yl)-3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1CCC(O)(CN2C(=O)NC(C)(c3ccco3)C2=O)CC1 |
| InChI | InChI=1S/C16H22N2O4/c1-11-5-7-16(21,8-6-11)10-18-13(19)15(2,17-14(18)20)12-4-3-9-22-12/h3-4,9,11,21H,5-8,10H2,1-2H3,(H,17,20) |
| InChIKey | CHSSIVUVJQZYIK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|