C14H16N2O5 — CID 77074921
methyl 4-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-methylbut-2-enoate (PubChem CID 77074921) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 4-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-methylbut-2-enoate.
| Compound Name | methyl 4-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 77074921 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 4-[4-(furan-2-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-methylbut-2-enoate |
| SMILES | COC(=O)C(C)=CCN1C(=O)NC(C)(c2ccco2)C1=O |
| InChI | InChI=1S/C14H16N2O5/c1-9(11(17)20-3)6-7-16-12(18)14(2,15-13(16)19)10-5-4-8-21-10/h4-6,8H,7H2,1-3H3,(H,15,19) |
| InChIKey | OKCYRHMZIMKTHD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|