C16H22N4O3 — CID 167933660
3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione (PubChem CID 167933660) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167933660 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 3-[(1-hydroxy-4-methylcyclohexyl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
| SMILES | CC1CCC(O)(CN2C(=O)NC(C)(c3cnccn3)C2=O)CC1 |
| InChI | InChI=1S/C16H22N4O3/c1-11-3-5-16(23,6-4-11)10-20-13(21)15(2,19-14(20)22)12-9-17-7-8-18-12/h7-9,11,23H,3-6,10H2,1-2H3,(H,19,22) |
| InChIKey | WQUHRPBPILAPTE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|