C17H15N5O3 — CID 167796115
3-[2-(1,2-benzoxazol-3-yl)ethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione (PubChem CID 167796115) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 3-[2-(1,2-benzoxazol-3-yl)ethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(1,2-benzoxazol-3-yl)ethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167796115 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-[2-(1,2-benzoxazol-3-yl)ethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2cnccn2)NC(=O)N(CCc2noc3ccccc23)C1=O |
| InChI | InChI=1S/C17H15N5O3/c1-17(14-10-18-7-8-19-14)15(23)22(16(24)20-17)9-6-12-11-4-2-3-5-13(11)25-21-12/h2-5,7-8,10H,6,9H2,1H3,(H,20,24) |
| InChIKey | HYDPNYLKFNHJOE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|