C17H19N5O2S — CID 138992176
3-[(2-cyclopentyl-1,3-thiazol-4-yl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione (PubChem CID 138992176) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 3-[(2-cyclopentyl-1,3-thiazol-4-yl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-cyclopentyl-1,3-thiazol-4-yl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138992176 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-[(2-cyclopentyl-1,3-thiazol-4-yl)methyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2cnccn2)NC(=O)N(Cc2csc(C3CCCC3)n2)C1=O |
| InChI | InChI=1S/C17H19N5O2S/c1-17(13-8-18-6-7-19-13)15(23)22(16(24)21-17)9-12-10-25-14(20-12)11-4-2-3-5-11/h6-8,10-11H,2-5,9H2,1H3,(H,21,24) |
| InChIKey | JCMHOTJSMVFJAE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|