C16H14F2N4O3 — CID 124624577
(5R)-3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione (PubChem CID 124624577) has the molecular formula C16H14F2N4O3 and a molecular weight of 348.31 g/mol. Its IUPAC name is (5R)-3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124624577 |
| Molecular Formula | C16H14F2N4O3 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (5R)-3-[(2S)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-pyrazin-2-ylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2cnccn2)NC(=O)N(C[C@@H](O)c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C16H14F2N4O3/c1-16(13-7-19-4-5-20-13)14(24)22(15(25)21-16)8-12(23)10-3-2-9(17)6-11(10)18/h2-7,12,23H,8H2,1H3,(H,21,25)/t12-,16-/m1/s1 |
| InChIKey | PTSXLAAGVVVBLC-MLGOLLRUSA-N |
| XLogP | 1.26 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|