C16H10F3NO3 — CID 111751775
2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-fluoroisoindole-1,3-dione (PubChem CID 111751775) has the molecular formula C16H10F3NO3 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-fluoroisoindole-1,3-dione.
| Compound Name | 2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 111751775 |
| Molecular Formula | C16H10F3NO3 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-fluoroisoindole-1,3-dione |
| SMILES | O=C1c2ccc(F)cc2C(=O)N1CC(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H10F3NO3/c17-8-1-3-10-12(5-8)16(23)20(15(10)22)7-14(21)11-4-2-9(18)6-13(11)19/h1-6,14,21H,7H2 |
| InChIKey | VTEZZBWGHGRLJJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|