C15H18F2N2O3 — CID 94389748
(5R)-3-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-propylimidazolidine-2,4-dione (PubChem CID 94389748) has the molecular formula C15H18F2N2O3 and a molecular weight of 312.32 g/mol. Its IUPAC name is (5R)-3-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-propylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94389748 |
| Molecular Formula | C15H18F2N2O3 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (5R)-3-[(2R)-2-(2,4-difluorophenyl)-2-hydroxyethyl]-5-methyl-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@@]1(C)NC(=O)N(C[C@H](O)c2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C15H18F2N2O3/c1-3-6-15(2)13(21)19(14(22)18-15)8-12(20)10-5-4-9(16)7-11(10)17/h4-5,7,12,20H,3,6,8H2,1-2H3,(H,18,22)/t12-,15+/m0/s1 |
| InChIKey | NWBRLYGIOQBTBV-SWLSCSKDSA-N |
| XLogP | 2.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|