C25H32N2O4 — CID 98678800
(5S)-5-butyl-3-[(2R)-2-hydroxy-3-[(R)-(4-methylphenyl)-phenylmethoxy]propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 98678800) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (5S)-5-butyl-3-[(2R)-2-hydroxy-3-[(R)-(4-methylphenyl)-phenylmethoxy]propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-butyl-3-[(2R)-2-hydroxy-3-[(R)-(4-methylphenyl)-phenylmethoxy]propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 98678800 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (5S)-5-butyl-3-[(2R)-2-hydroxy-3-[(R)-(4-methylphenyl)-phenylmethoxy]propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCC[C@]1(C)NC(=O)N(C[C@@H](O)CO[C@H](c2ccccc2)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C25H32N2O4/c1-4-5-15-25(3)23(29)27(24(30)26-25)16-21(28)17-31-22(19-9-7-6-8-10-19)20-13-11-18(2)12-14-20/h6-14,21-22,28H,4-5,15-17H2,1-3H3,(H,26,30)/t21-,22-,25+/m1/s1 |
| InChIKey | UJRIHCYIWBPAOD-RQTOMXEWSA-N |
| XLogP | 3.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|