C24H30N2O4 — CID 31571826
5,5-diethyl-3-[(2R)-2-hydroxy-3-[(S)-(2-methylphenyl)-phenylmethoxy]propyl]imidazolidine-2,4-dione (PubChem CID 31571826) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 5,5-diethyl-3-[(2R)-2-hydroxy-3-[(S)-(2-methylphenyl)-phenylmethoxy]propyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diethyl-3-[(2R)-2-hydroxy-3-[(S)-(2-methylphenyl)-phenylmethoxy]propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31571826 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 5,5-diethyl-3-[(2R)-2-hydroxy-3-[(S)-(2-methylphenyl)-phenylmethoxy]propyl]imidazolidine-2,4-dione |
| SMILES | CCC1(CC)NC(=O)N(C[C@@H](O)CO[C@@H](c2ccccc2)c2ccccc2C)C1=O |
| InChI | InChI=1S/C24H30N2O4/c1-4-24(5-2)22(28)26(23(29)25-24)15-19(27)16-30-21(18-12-7-6-8-13-18)20-14-10-9-11-17(20)3/h6-14,19,21,27H,4-5,15-16H2,1-3H3,(H,25,29)/t19-,21+/m1/s1 |
| InChIKey | NZWPZLVOTIFSTO-CTNGQTDRSA-N |
| XLogP | 3.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|