C20H21N3O4 — CID 51940184
(2R)-1-[(S)-(2-methylphenyl)-phenylmethoxy]-3-(4-nitroimidazol-1-yl)propan-2-ol (PubChem CID 51940184) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (2R)-1-[(S)-(2-methylphenyl)-phenylmethoxy]-3-(4-nitroimidazol-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[(S)-(2-methylphenyl)-phenylmethoxy]-3-(4-nitroimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 51940184 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (2R)-1-[(S)-(2-methylphenyl)-phenylmethoxy]-3-(4-nitroimidazol-1-yl)propan-2-ol |
| SMILES | Cc1ccccc1[C@@H](OC[C@H](O)Cn1cnc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O4/c1-15-7-5-6-10-18(15)20(16-8-3-2-4-9-16)27-13-17(24)11-22-12-19(21-14-22)23(25)26/h2-10,12,14,17,20,24H,11,13H2,1H3/t17-,20+/m1/s1 |
| InChIKey | KLMILASXEVQBTR-XLIONFOSSA-N |
| XLogP | 3.27 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|