C21H29NO2 — CID 2124057
(2S)-1-(butylamino)-3-[(S)-(2-methylphenyl)-phenylmethoxy]propan-2-ol (PubChem CID 2124057) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (2S)-1-(butylamino)-3-[(S)-(2-methylphenyl)-phenylmethoxy]propan-2-ol.
| Compound Name | (2S)-1-(butylamino)-3-[(S)-(2-methylphenyl)-phenylmethoxy]propan-2-ol |
|---|---|
| PubChem CID | 2124057 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (2S)-1-(butylamino)-3-[(S)-(2-methylphenyl)-phenylmethoxy]propan-2-ol |
| SMILES | CCCCNC[C@H](O)CO[C@@H](c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C21H29NO2/c1-3-4-14-22-15-19(23)16-24-21(18-11-6-5-7-12-18)20-13-9-8-10-17(20)2/h5-13,19,21-23H,3-4,14-16H2,1-2H3/t19-,21-/m0/s1 |
| InChIKey | CHVOWXWAJUQTSR-FPOVZHCZSA-N |
| XLogP | 3.85 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|