C19H22N2O4 — CID 31570678
(5R)-5-ethyl-3-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 31570678) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is (5R)-5-ethyl-3-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-3-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31570678 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (5R)-5-ethyl-3-[(2R)-2-hydroxy-3-naphthalen-2-yloxypropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC[C@@]1(C)NC(=O)N(C[C@@H](O)COc2ccc3ccccc3c2)C1=O |
| InChI | InChI=1S/C19H22N2O4/c1-3-19(2)17(23)21(18(24)20-19)11-15(22)12-25-16-9-8-13-6-4-5-7-14(13)10-16/h4-10,15,22H,3,11-12H2,1-2H3,(H,20,24)/t15-,19-/m1/s1 |
| InChIKey | UHNZITZFQPRGDH-DNVCBOLYSA-N |
| XLogP | 2.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|