C17H19Cl2NO4 — CID 31579870
2-[(2R)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 31579870) has the molecular formula C17H19Cl2NO4 and a molecular weight of 372.25 g/mol. Its IUPAC name is 2-[(2R)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione.
| Compound Name | 2-[(2R)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 31579870 |
| Molecular Formula | C17H19Cl2NO4 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-[(2R)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCCC2)C(=O)N1C[C@@H](O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H19Cl2NO4/c18-12-4-3-5-13(19)15(12)24-10-11(21)9-20-14(22)8-17(16(20)23)6-1-2-7-17/h3-5,11,21H,1-2,6-10H2/t11-/m1/s1 |
| InChIKey | BYZJFPKRAUPFBM-LLVKDONJSA-N |
| XLogP | 3.05 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|