C17H19Cl2NO4 — CID 124739699
(3aR,7aR)-2-[(2S)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 124739699) has the molecular formula C17H19Cl2NO4 and a molecular weight of 372.25 g/mol. Its IUPAC name is (3aR,7aR)-2-[(2S)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[(2S)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124739699 |
| Molecular Formula | C17H19Cl2NO4 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | (3aR,7aR)-2-[(2S)-3-(2,6-dichlorophenoxy)-2-hydroxypropyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCC[C@H]2C(=O)N1C[C@H](O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H19Cl2NO4/c18-13-6-3-7-14(19)15(13)24-9-10(21)8-20-16(22)11-4-1-2-5-12(11)17(20)23/h3,6-7,10-12,21H,1-2,4-5,8-9H2/t10-,11+,12+/m0/s1 |
| InChIKey | TWNXHANUDPIEMJ-QJPTWQEYSA-N |
| XLogP | 2.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|