C15H21Cl2NO3 — CID 62360958
2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]cyclohexan-1-ol (PubChem CID 62360958) has the molecular formula C15H21Cl2NO3 and a molecular weight of 334.24 g/mol. Its IUPAC name is 2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]cyclohexan-1-ol.
| Compound Name | 2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 62360958 |
| Molecular Formula | C15H21Cl2NO3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]cyclohexan-1-ol |
| SMILES | OC(CNC1CCCCC1O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H21Cl2NO3/c16-11-4-3-5-12(17)15(11)21-9-10(19)8-18-13-6-1-2-7-14(13)20/h3-5,10,13-14,18-20H,1-2,6-9H2 |
| InChIKey | FQLQRDXIHDUSSW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |