C15H21Cl2NO2S — CID 80595228
1-(2,6-dichlorophenoxy)-3-(thian-2-ylmethylamino)propan-2-ol (PubChem CID 80595228) has the molecular formula C15H21Cl2NO2S and a molecular weight of 350.31 g/mol. Its IUPAC name is 1-(2,6-dichlorophenoxy)-3-(thian-2-ylmethylamino)propan-2-ol.
| Compound Name | 1-(2,6-dichlorophenoxy)-3-(thian-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 80595228 |
| Molecular Formula | C15H21Cl2NO2S |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(2,6-dichlorophenoxy)-3-(thian-2-ylmethylamino)propan-2-ol |
| SMILES | OC(CNCC1CCCCS1)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H21Cl2NO2S/c16-13-5-3-6-14(17)15(13)20-10-11(19)8-18-9-12-4-1-2-7-21-12/h3,5-6,11-12,18-19H,1-2,4,7-10H2 |
| InChIKey | VCMGMFMUALQNOW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |