C12H17Cl2N3O3 — CID 83120734
2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]ethylurea (PubChem CID 83120734) has the molecular formula C12H17Cl2N3O3 and a molecular weight of 322.19 g/mol. Its IUPAC name is 2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]ethylurea.
| Compound Name | 2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]ethylurea |
|---|---|
| PubChem CID | 83120734 |
| Molecular Formula | C12H17Cl2N3O3 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2-[[3-(2,6-dichlorophenoxy)-2-hydroxypropyl]amino]ethylurea |
| SMILES | NC(=O)NCCNCC(O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H17Cl2N3O3/c13-9-2-1-3-10(14)11(9)20-7-8(18)6-16-4-5-17-12(15)19/h1-3,8,16,18H,4-7H2,(H3,15,17,19) |
| InChIKey | MSVNUJWPBCKGRG-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|