C14H23N3O3 — CID 83121787
2-[[2-hydroxy-3-(1-phenylethoxy)propyl]amino]ethylurea (PubChem CID 83121787) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[[2-hydroxy-3-(1-phenylethoxy)propyl]amino]ethylurea.
| Compound Name | 2-[[2-hydroxy-3-(1-phenylethoxy)propyl]amino]ethylurea |
|---|---|
| PubChem CID | 83121787 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-[[2-hydroxy-3-(1-phenylethoxy)propyl]amino]ethylurea |
| SMILES | CC(OCC(O)CNCCNC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C14H23N3O3/c1-11(12-5-3-2-4-6-12)20-10-13(18)9-16-7-8-17-14(15)19/h2-6,11,13,16,18H,7-10H2,1H3,(H3,15,17,19) |
| InChIKey | HGKRFJCZZIJQFJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|