C14H18N4O3S — CID 51084625
1-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 51084625) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 51084625 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-[2-hydroxy-3-(1-phenylethoxy)propyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | CC(OCC(O)CNC(=O)Nc1nncs1)c1ccccc1 |
| InChI | InChI=1S/C14H18N4O3S/c1-10(11-5-3-2-4-6-11)21-8-12(19)7-15-13(20)17-14-18-16-9-22-14/h2-6,9-10,12,19H,7-8H2,1H3,(H2,15,17,18,20) |
| InChIKey | IDFFXMGZICGFMT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |