C9H16N4O2S — CID 95977557
1-[(2R)-2-hydroxy-4-methylpentyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 95977557) has the molecular formula C9H16N4O2S and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-4-methylpentyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(2R)-2-hydroxy-4-methylpentyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 95977557 |
| Molecular Formula | C9H16N4O2S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-[(2R)-2-hydroxy-4-methylpentyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | CC(C)C[C@@H](O)CNC(=O)Nc1nncs1 |
| InChI | InChI=1S/C9H16N4O2S/c1-6(2)3-7(14)4-10-8(15)12-9-13-11-5-16-9/h5-7,14H,3-4H2,1-2H3,(H2,10,12,13,15)/t7-/m1/s1 |
| InChIKey | OGTALRIAIKEGRJ-SSDOTTSWSA-N |
| XLogP | 1.07 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |