C10H17N5OS — CID 95284419
1-[(2S)-2-pyrrolidin-1-ylpropyl]-3-(1,3,4-thiadiazol-2-yl)urea (PubChem CID 95284419) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is 1-[(2S)-2-pyrrolidin-1-ylpropyl]-3-(1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[(2S)-2-pyrrolidin-1-ylpropyl]-3-(1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 95284419 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-[(2S)-2-pyrrolidin-1-ylpropyl]-3-(1,3,4-thiadiazol-2-yl)urea |
| SMILES | C[C@@H](CNC(=O)Nc1nncs1)N1CCCC1 |
| InChI | InChI=1S/C10H17N5OS/c1-8(15-4-2-3-5-15)6-11-9(16)13-10-14-12-7-17-10/h7-8H,2-6H2,1H3,(H2,11,13,14,16)/t8-/m0/s1 |
| InChIKey | DCMRTFXTZNZUDW-QMMMGPOBSA-N |
| XLogP | 1.14 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |