C12H12N4O3S — CID 62878500
2-phenyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid (PubChem CID 62878500) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-phenyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid.
| Compound Name | 2-phenyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 62878500 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 2-phenyl-3-(1,3,4-thiadiazol-2-ylcarbamoylamino)propanoic acid |
| SMILES | O=C(NCC(C(=O)O)c1ccccc1)Nc1nncs1 |
| InChI | InChI=1S/C12H12N4O3S/c17-10(18)9(8-4-2-1-3-5-8)6-13-11(19)15-12-16-14-7-20-12/h1-5,7,9H,6H2,(H,17,18)(H2,13,15,16,19) |
| InChIKey | ZHDRLMVNZKASGN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |