C12H20N4OS — CID 95131197
1-[(2S)-2-pyrrolidin-1-ylbutyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 95131197) has the molecular formula C12H20N4OS and a molecular weight of 268.39 g/mol. Its IUPAC name is 1-[(2S)-2-pyrrolidin-1-ylbutyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(2S)-2-pyrrolidin-1-ylbutyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 95131197 |
| Molecular Formula | C12H20N4OS |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-[(2S)-2-pyrrolidin-1-ylbutyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | CC[C@@H](CNC(=O)Nc1nccs1)N1CCCC1 |
| InChI | InChI=1S/C12H20N4OS/c1-2-10(16-6-3-4-7-16)9-14-11(17)15-12-13-5-8-18-12/h5,8,10H,2-4,6-7,9H2,1H3,(H2,13,14,15,17)/t10-/m0/s1 |
| InChIKey | XZUMHMMNKNNYAJ-JTQLQIEISA-N |
| XLogP | 2.14 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |