C9H13N3O3S — CID 115428250
2,2-dimethyl-3-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid (PubChem CID 115428250) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2,2-dimethyl-3-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 115428250 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2,2-dimethyl-3-(1,3-thiazol-2-ylcarbamoylamino)propanoic acid |
| SMILES | CC(C)(CNC(=O)Nc1nccs1)C(=O)O |
| InChI | InChI=1S/C9H13N3O3S/c1-9(2,6(13)14)5-11-7(15)12-8-10-3-4-16-8/h3-4H,5H2,1-2H3,(H,13,14)(H2,10,11,12,15) |
| InChIKey | IPERSDVERLFHSO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |