2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid

C8H12N4O3S — CID 114913207

IUPAC2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid
SMILESCC(C)(CNC(=O)Nc1cnns1)C(=O)O
InChIInChI=1S/C8H12N4O3S/c1-8(2,6(13)14)4-9-7(15)11-5-3-10-12-16-5/h3H,4H2,1-2H3,(H,13,14)(H2,9,11,15)
InChIKeyNFKOXBWFPKGQHH-UHFFFAOYSA-N
MW244.28 g/mol
LogP0.77
Rot. Bonds4

About 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid

2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid (PubChem CID 114913207) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid.

Molecular Properties

Compound Name2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid
PubChem CID114913207
Molecular FormulaC8H12N4O3S
Molecular Weight244.28 g/mol
Exact Mass244.06
IUPAC Name2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid
SMILESCC(C)(CNC(=O)Nc1cnns1)C(=O)O
InChIInChI=1S/C8H12N4O3S/c1-8(2,6(13)14)4-9-7(15)11-5-3-10-12-16-5/h3H,4H2,1-2H3,(H,13,14)(H2,9,11,15)
InChIKeyNFKOXBWFPKGQHH-UHFFFAOYSA-N
XLogP0.77
TPSA104.21 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.28
LogP ≤ 50.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid?
The IUPAC name of 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid (CID 114913207) is 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid.
What is the SMILES notation for 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid?
The canonical SMILES for 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid is CC(C)(CNC(=O)Nc1cnns1)C(=O)O.
What is the InChIKey of 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid?
The InChIKey is NFKOXBWFPKGQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3S/c1-8(2,6(13)14)4-9-7(15)11-5-3-10-12-16-5/h3H,4H2,1-2H3,(H,13,14)(H2,9,11,15).
What are the key properties of 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid?
2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid has a molecular weight of 244.28 g/mol, XLogP of 0.77, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid is sourced from PubChem (CID 114913207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).