C8H12N4O3S — CID 114913207
2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid (PubChem CID 114913207) has the molecular formula C8H12N4O3S and a molecular weight of 244.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 114913207 |
| Molecular Formula | C8H12N4O3S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2,2-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)propanoic acid |
| SMILES | CC(C)(CNC(=O)Nc1cnns1)C(=O)O |
| InChI | InChI=1S/C8H12N4O3S/c1-8(2,6(13)14)4-9-7(15)11-5-3-10-12-16-5/h3H,4H2,1-2H3,(H,13,14)(H2,9,11,15) |
| InChIKey | NFKOXBWFPKGQHH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |