C9H8N4O4S — CID 114913031
5-[(thiadiazol-5-ylcarbamoylamino)methyl]furan-2-carboxylic acid (PubChem CID 114913031) has the molecular formula C9H8N4O4S and a molecular weight of 268.25 g/mol. Its IUPAC name is 5-[(thiadiazol-5-ylcarbamoylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(thiadiazol-5-ylcarbamoylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 114913031 |
| Molecular Formula | C9H8N4O4S |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 5-[(thiadiazol-5-ylcarbamoylamino)methyl]furan-2-carboxylic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)o1)Nc1cnns1 |
| InChI | InChI=1S/C9H8N4O4S/c14-8(15)6-2-1-5(17-6)3-10-9(16)12-7-4-11-13-18-7/h1-2,4H,3H2,(H,14,15)(H2,10,12,16) |
| InChIKey | PSTSIEIOZBBJKN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |