C11H9BrN2O3 — CID 114051655
5-[[(6-bromo-3-pyridinyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 114051655) has the molecular formula C11H9BrN2O3 and a molecular weight of 297.11 g/mol. Its IUPAC name is 5-[[(6-bromo-3-pyridinyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(6-bromo-3-pyridinyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 114051655 |
| Molecular Formula | C11H9BrN2O3 |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 5-[[(6-bromo-3-pyridinyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2ccc(Br)nc2)o1 |
| InChI | InChI=1S/C11H9BrN2O3/c12-10-4-1-7(5-14-10)13-6-8-2-3-9(17-8)11(15)16/h1-5,13H,6H2,(H,15,16) |
| InChIKey | WCUVECBJVOHCRD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|