C10H9NO3S — CID 66350799
5-[(thiophen-3-ylamino)methyl]furan-2-carboxylic acid (PubChem CID 66350799) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 5-[(thiophen-3-ylamino)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(thiophen-3-ylamino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 66350799 |
| Molecular Formula | C10H9NO3S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 5-[(thiophen-3-ylamino)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2ccsc2)o1 |
| InChI | InChI=1S/C10H9NO3S/c12-10(13)9-2-1-8(14-9)5-11-7-3-4-15-6-7/h1-4,6,11H,5H2,(H,12,13) |
| InChIKey | RVENMIPPXJYOKY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |