C11H18N4O3S — CID 114913212
5,5-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid (PubChem CID 114913212) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is 5,5-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid.
| Compound Name | 5,5-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 114913212 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5,5-dimethyl-3-(thiadiazol-5-ylcarbamoylamino)hexanoic acid |
| SMILES | CC(C)(C)CC(CC(=O)O)NC(=O)Nc1cnns1 |
| InChI | InChI=1S/C11H18N4O3S/c1-11(2,3)5-7(4-9(16)17)13-10(18)14-8-6-12-15-19-8/h6-7H,4-5H2,1-3H3,(H,16,17)(H2,13,14,18) |
| InChIKey | VTLIPQUCTZMTFM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |